CymitQuimica logo

CAS 898770-32-6

:

(2-fluorophenyl)-[4-(morpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (2-fluorophenyl)-[4-(morpholinomethyl)phenyl]methanone, with the CAS number 898770-32-6, is characterized by its complex molecular structure, which includes a fluorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in medicinal chemistry. The morpholine ring adds to the compound's potential for forming hydrogen bonds, which can affect its interaction with biological targets. Additionally, the ketone functional group is likely to participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound may be explored for its applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C18H18FNO2
InChI:InChI=1/C18H18FNO2/c19-17-4-2-1-3-16(17)18(21)15-7-5-14(6-8-15)13-20-9-11-22-12-10-20/h1-8H,9-13H2
SMILES:c1ccc(c(c1)C(=O)c1ccc(cc1)CN1CCOCC1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.