CAS 898770-34-8

Methanone, (2,3-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,3-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,3-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its physical and chemical properties, such as solubility and reactivity. The incorporation of a pyrrolidinylmethyl group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. This compound may exhibit various properties, including potential pharmacological activity, due to the presence of the nitrogen-containing pyrrolidine ring, which can participate in hydrogen bonding and other interactions. Its molecular structure may also affect its stability, melting point, and boiling point, although specific values would depend on experimental conditions. Overall, this compound represents a class of organic molecules that could have applications in drug development or other chemical research fields.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-15-7-5-10-19(16(15)2)20(22)18-9-6-8-17(13-18)14-21-11-3-4-12-21/h5-10,13H,3-4,11-12,14H2,1-2H3

InChI key: InChIKey=OITALFBLQZTBLB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=C(C)C(C)=CC=C3

Synonyms:

• (2,3-Dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (2,3-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

2,3-dimethyl-3′-pyrrolidinomethyl benzophenone

CAS: 898770-34-8

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F204789