CAS 898770-36-0

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(2-methoxyphenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(2-methoxyphenyl)-, identified by CAS number 898770-36-0, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromo-2-fluorophenyl group and a 2-methoxyphenyl group. The presence of bromine and fluorine atoms introduces notable electronegative characteristics, which can influence the compound's reactivity and polarity. The methoxy group contributes to the compound's overall hydrophobicity while also providing potential sites for hydrogen bonding. This compound may exhibit interesting biological activities due to its structural complexity and the presence of halogen substituents, which can enhance its interaction with biological targets. Additionally, its solubility and stability in various solvents can vary, making it relevant in synthetic organic chemistry and potential pharmaceutical applications. Overall, the unique combination of functional groups and substituents in this compound suggests a diverse range of chemical behaviors and potential applications.

Formula: C₁₆H₁₄BrFO₂

InChI: InChI=1S/C16H14BrFO2/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3

InChI key: InChIKey=VEGUHSHPMFTMMO-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=C(Br)C=C1)C2=C(OC)C=CC=C2

Synonyms:

• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(2-methoxyphenyl)-
• 1-(4-Bromo-2-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone
• 4′-Bromo-2′-fluoro-3-(2-methoxyphenyl)propiophenone

4′-bromo-2′-fluoro-3-(2-methoxyphenyl)propiophenone

CAS: 898770-36-0

Formula: C₁₆H₁₄BrFO₂

Purity: 97.0%

Molecular weight: 337.188

Ref: 10-F205811