CAS 898770-40-6

Methanone, (2,5-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, which can influence its reactivity and physical properties. The compound also features a pyrrolidinylmethyl group, suggesting potential interactions with biological systems, as pyrrolidine derivatives are often associated with pharmacological activity. This compound may exhibit properties such as moderate to high lipophilicity due to its aromatic and aliphatic components, which can affect its solubility in organic solvents and its behavior in biological environments. Additionally, the presence of multiple functional groups may lead to diverse reactivity patterns, making it of interest in synthetic organic chemistry and medicinal chemistry. However, specific data regarding its melting point, boiling point, and other physical properties would require experimental determination or literature references.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-15-8-9-16(2)19(12-15)20(22)18-7-5-6-17(13-18)14-21-10-3-4-11-21/h5-9,12-13H,3-4,10-11,14H2,1-2H3

InChI key: InChIKey=UAMGRWVIOSAPKL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=C(C)C=CC(C)=C3

Synonyms:

• 2,5-Dimethyl-3′-pyrrolidinomethyl benzophenone
• (2,5-Dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (2,5-dimethylphenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

2,5-dimethyl-3′-pyrrolidinomethyl benzophenone

CAS: 898770-40-6

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F204791