CAS 898770-41-7
:Methanone, [4-(4-morpholinylmethyl)phenyl][4-(trifluoromethyl)phenyl]-
Description:
Methanone, [4-(4-morpholinylmethyl)phenyl][4-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of these rings is substituted with a morpholinylmethyl group, while the other features a trifluoromethyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The morpholine moiety may also impart specific interactions with biological targets, potentially affecting the compound's pharmacokinetics and pharmacodynamics. This compound is typically synthesized through multi-step organic reactions and may be utilized in various applications, including medicinal chemistry and material science. Its CAS number, 898770-41-7, allows for easy identification and retrieval of information in chemical databases. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C19H18F3NO2
InChI:InChI=1S/C19H18F3NO2/c20-19(21,22)17-7-5-16(6-8-17)18(24)15-3-1-14(2-4-15)13-23-9-11-25-12-10-23/h1-8H,9-13H2
InChI key:InChIKey=RJTHEZJUVAYOTG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(F)(F)F)C=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:- Methanone, [4-(4-morpholinylmethyl)phenyl][4-(trifluoromethyl)phenyl]-
- [4-(4-Morpholinylmethyl)phenyl][4-(trifluoromethyl)phenyl]methanone
- 4-Morpholinomethyl-4′-trifluoromethylbenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.