CAS 898770-42-8

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2-methoxyphenyl)-

Description:

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2-methoxyphenyl)-, also known by its CAS number 898770-42-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 2-methoxyphenyl group. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity and physical properties, including its solubility and boiling point. The methoxy group contributes to the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure of the compound. Safety data and handling precautions should be consulted, as halogenated compounds can exhibit toxicity or environmental hazards.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1S/C16H14ClFO2/c1-20-16-5-3-2-4-11(16)6-7-15(19)12-8-13(17)10-14(18)9-12/h2-5,8-10H,6-7H2,1H3

InChI key: InChIKey=GYNHJZYFCXRBNB-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(Cl)=CC(F)=C1)C2=C(OC)C=CC=C2

Synonyms:

• 1-(3-Chloro-5-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone
• 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2-methoxyphenyl)-
• 3′-Chloro-5′-fluoro-3-(2-methoxyphenyl)propiophenone