CAS 898770-45-1

1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyphenyl)-

Description:

1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyphenyl)-, also known by its CAS number 898770-45-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chloro-2-fluorophenyl group and a 2-methoxyphenyl group. The presence of halogen atoms, such as chlorine and fluorine, in the aromatic ring can influence its reactivity and physical properties, including polarity and solubility. The methoxy group contributes to the compound's overall electronic characteristics, potentially affecting its interactions in chemical reactions. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to their aromatic structures, which can impact their biological activity and pharmacokinetics. Additionally, the compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways or receptors. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1S/C16H14ClFO2/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3

InChI key: InChIKey=WYMBOPQHTDWCJO-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=C(Cl)C=C1)C2=C(OC)C=CC=C2

Synonyms:

• 1-(4-Chloro-2-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone
• 4′-Chloro-2′-fluoro-3-(2-methoxyphenyl)propiophenone
• 1-Propanone, 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyphenyl)-