CAS 898770-54-2

Methanone, (4-chloro-3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-chloro and a 3-fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and interactions. The compound also features a pyrrolidinylmethyl group, which may enhance its biological activity and solubility. Typically, such compounds are studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of halogen atoms (chlorine and fluorine) often affects the compound's lipophilicity and metabolic stability. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in various chemical and biological applications.

Formula: C₁₈H₁₇ClFNO

InChI: InChI=1S/C18H17ClFNO/c19-16-7-6-15(11-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

InChI key: InChIKey=TXNIYDOBXHVIFZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(F)=C(Cl)C=C3

Synonyms:

• 4-Chloro-3-fluoro-3′-pyrrolidinomethyl benzophenone
• Methanone, (4-chloro-3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
• (4-Chloro-3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone

4-chloro-3-fluoro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-54-2

Formula: C₁₈H₁₇ClFNO

Purity: 97.0%

Molecular weight: 317.79

Ref: 10-F204796