CAS 898770-55-3

Methanone, (2,3-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that the compound has two chlorine atoms substituted on the phenyl ring, which can influence its reactivity and physical properties. The morpholinylmethyl group suggests that the compound has a morpholine ring, a six-membered heterocyclic structure containing oxygen and nitrogen, which can enhance its solubility and biological activity. This compound is likely to exhibit specific interactions due to its functional groups, making it of interest in medicinal chemistry and drug development. Its molecular structure may contribute to its potential as a pharmaceutical agent, possibly affecting its pharmacokinetics and pharmacodynamics. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as temperature and pH. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1S/C18H17Cl2NO2/c19-16-3-1-2-15(17(16)20)18(22)14-6-4-13(5-7-14)12-21-8-10-23-11-9-21/h1-7H,8-12H2

InChI key: InChIKey=LCTXGMOVMXDPPF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• 2,3-Dichloro-4′-morpholinomethyl benzophenone
• (2,3-Dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (2,3-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]-

2,3-dichloro-4′-morpholinomethyl benzophenone

CAS: 898770-55-3

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F204238