CAS 898770-56-4

Methanone, (3-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The pyrrolidinylmethyl group indicates that this compound may exhibit properties associated with amines, potentially influencing its interaction with biological systems. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic nature. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks are often investigated for their therapeutic properties. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₈H₁₇ClFNO

InChI: InChI=1S/C18H17ClFNO/c19-16-11-15(6-7-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

InChI key: InChIKey=LXBURPITSUZFFI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• 3-Chloro-4-fluoro-3′-pyrrolidinomethyl-benzophenone
• (3-Chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

3-chloro-4-fluoro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-56-4

Formula: C₁₈H₁₇ClFNO

Purity: 97.0%

Molecular weight: 317.79

Ref: 10-F204797