CymitQuimica logo

CAS 898770-58-6

:

(2-chlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (2-chlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898770-58-6, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a pyrrolidinylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl moiety may influence its lipophilicity and reactivity, while the pyrrolidine ring can impart unique steric and electronic characteristics. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may interact with various biological targets, making it of interest in drug discovery and development. Additionally, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound represents a class of molecules that may have significant implications in therapeutic contexts.
Formula:C18H18ClNO
InChI:InChI=1/C18H18ClNO/c19-17-9-2-1-8-16(17)18(21)15-7-5-6-14(12-15)13-20-10-3-4-11-20/h1-2,5-9,12H,3-4,10-11,13H2
SMILES:c1ccc(c(c1)C(=O)c1cccc(c1)CN1CCCC1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.