CAS 898770-59-7
:(2,5-dichlorophenyl)-[4-(morpholinomethyl)phenyl]methanone
Description:
(2,5-Dichlorophenyl)-[4-(morpholinomethyl)phenyl]methanone, with CAS number 898770-59-7, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may possess significant lipophilicity, which can influence its solubility and permeability in biological systems. The morpholine ring adds to its pharmacological profile, potentially enhancing interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with specific receptors or enzymes. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography to confirm its molecular structure. Overall, the compound's unique characteristics make it a subject of interest for further research in various chemical and biological applications.
Formula:C18H17Cl2NO2
InChI:InChI=1/C18H17Cl2NO2/c19-15-5-6-17(20)16(11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
SMILES:c1cc(ccc1CN1CCOCC1)C(=O)c1cc(ccc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.