CAS 898770-61-1

Methanone, (3,4-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that the compound has chlorine substituents on the aromatic ring, which can influence its reactivity and physical properties. Additionally, the inclusion of a morpholine moiety suggests potential applications in medicinal chemistry, as morpholine derivatives are often associated with biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may affect its solubility in various solvents. The molecular structure may also impart specific interactions with biological targets, making it of interest in drug design. Safety and handling precautions should be observed, as with many organic compounds, particularly those with halogen substituents, due to potential toxicity or environmental impact. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1/C18H17Cl2NO2/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=PXIVFWQKYOMVSM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Methanone, (3,4-dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]-
• 3,4-Dichloro-4′-morpholinomethyl benzophenone
• (3,4-Dichlorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone

3,4-dichloro-4′-morpholinomethyl benzophenone

CAS: 898770-61-1

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F204241