CymitQuimica logo

CAS 898770-62-2

:

[3-(pyrrolidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [3-(pyrrolidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898770-62-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with a trifluoromethyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, while the pyrrolidine ring may influence its interaction with biological targets. Such compounds are of interest in medicinal chemistry for their potential applications in drug development, particularly in areas like neuropharmacology or as inhibitors in various biochemical pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by its functional groups, making it a subject of study for its pharmacokinetic and pharmacodynamic properties. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in chemical research.
Formula:C19H18F3NO
InChI:InChI=1/C19H18F3NO/c20-19(21,22)17-9-2-1-8-16(17)18(24)15-7-5-6-14(12-15)13-23-10-3-4-11-23/h1-2,5-9,12H,3-4,10-11,13H2
SMILES:c1ccc(c(c1)C(=O)c1cccc(c1)CN1CCCC1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.