CAS 898770-65-5

Methanone, (2,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its reactivity and physical properties, such as polarity and boiling point. The morpholinylmethyl group adds a morpholine ring, a six-membered heterocyclic structure containing oxygen and nitrogen, which can enhance the compound's solubility and biological activity. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various diseases. The compound's stability, solubility, and reactivity can be influenced by the arrangement of its substituents, making it a subject of study in both synthetic and medicinal chemistry.

Formula: C₁₈H₁₇F₂NO₂

InChI: InChI=1S/C18H17F2NO2/c19-15-5-6-16(17(20)11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=SVCAORHLOSOIMM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Methanone, (2,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-
• (2,4-Difluorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone