CAS 898770-67-7
:Methanone, (3,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-
Description:
Methanone, (3,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of difluorophenyl and morpholinylmethyl substituents contributes to its unique chemical properties. This compound is likely to exhibit significant lipophilicity due to its aromatic components, which may influence its solubility and interaction with biological systems. The morpholine ring suggests potential for interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the fluorine atoms can enhance metabolic stability and alter the electronic properties of the molecule, potentially affecting its reactivity and binding affinity. Overall, this compound's characteristics, including its molecular structure and substituents, suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity would require further investigation through experimental studies.
Formula:C18H17F2NO2
InChI:InChI=1/C18H17F2NO2/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
InChI key:InChIKey=LVIZQAHCKFHQCJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:- (3,4-Difluorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
- 3,4-Difluoro-4′-morpholinomethyl benzophenone
- Methanone, (3,4-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-
- (3,4-Difluorophenyl)(4-(morpholinomethyl)phenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.