CAS 898770-68-8

Methanone, (4-bromo-2-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-bromo-2-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The pyrrolidinylmethyl group suggests that the compound may exhibit properties relevant to medicinal chemistry, possibly influencing its interaction with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic nature. Its molecular structure may impart specific pharmacological properties, making it of interest in drug discovery and development. As with many compounds containing halogens and nitrogen heterocycles, it may also exhibit interesting electronic properties, which could be relevant in various chemical applications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₈H₁₇BrFNO

InChI: InChI=1S/C18H17BrFNO/c19-15-6-7-16(17(20)11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

InChI key: InChIKey=PLKHNQWELZINEV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Br)C=C1)C2=CC(CN3CCCC3)=CC=C2

Synonyms:

• Methanone, (4-bromo-2-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
• (4-Bromo-2-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone

4-bromo-2-fluoro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-68-8

Formula: C₁₈H₁₇BrFNO

Purity: 97.0%

Molecular weight: 362.242

Ref: 10-F204803