CAS 898770-69-9
:Methanone, (3,5-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-
Description:
Methanone, (3,5-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its electronic properties and reactivity. Additionally, the compound features a morpholinylmethyl substituent, which introduces a morpholine ring—a six-membered heterocycle containing oxygen and nitrogen—contributing to its potential biological activity and solubility characteristics. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and the ability to participate in various chemical reactions. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H17F2NO2
InChI:InChI=1S/C18H17F2NO2/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-13(2-4-14)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2
InChI key:InChIKey=PQRVOJLJHLTZHY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:- (3,5-Difluorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
- 3,5-Difluoro-4′-morpholinomethyl benzophenone
- Methanone, (3,5-difluorophenyl)[4-(4-morpholinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.