CAS 898770-70-2
:Methanone, (2-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
Description:
Methanone, (2-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The pyrrolidinylmethyl group suggests that the compound may exhibit interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates potential for lipophilicity, which can affect its solubility and permeability in biological systems. The compound's CAS number, 898770-70-2, allows for easy identification and retrieval of information in chemical databases. Overall, this compound may have applications in pharmaceuticals or as a research chemical, but specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C18H17ClFNO
InChI:InChI=1S/C18H17ClFNO/c19-17-11-15(20)6-7-16(17)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2
InChI key:InChIKey=OGBGPQYZPGKGPJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC(CN3CCCC3)=CC=C2
Synonyms:- 2-Chloro-4-fluoro-3′-pyrrolidinomethyl benzophenone
- Methanone, (2-chloro-4-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.