CymitQuimica logo

CAS 898770-72-4

:

(3-chloro-5-fluoro-phenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (3-chloro-5-fluoro-phenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898770-72-4, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a pyrrolidine moiety. This compound typically exhibits properties associated with its functional groups, such as potential reactivity due to the presence of the carbonyl group in the methanone structure. The chlorofluorophenyl group may impart specific electronic characteristics, influencing its interactions in biological systems or chemical reactions. Additionally, the pyrrolidine ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.
Formula:C18H17ClFNO
InChI:InChI=1/C18H17ClFNO/c19-16-9-15(10-17(20)11-16)18(22)14-5-3-4-13(8-14)12-21-6-1-2-7-21/h3-5,8-11H,1-2,6-7,12H2
SMILES:C1CCN(C1)Cc1cccc(c1)C(=O)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.