CAS 898770-76-8

Methanone, (2,3-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that the compound has two chlorine substituents on a phenyl ring, which can influence its reactivity and physical properties. The pyrrolidinylmethyl substituent suggests that the compound may exhibit certain biological activities, potentially interacting with neurotransmitter systems due to the presence of the pyrrolidine moiety. This compound is likely to be a solid at room temperature, with specific solubility characteristics depending on the solvent used, influenced by its polar and non-polar regions. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its behavior, including its stability, reactivity, and potential applications in various fields such as pharmaceuticals or agrochemicals. Safety data and handling precautions should be considered due to the presence of chlorine atoms, which can pose health risks.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-16-8-4-7-15(17(16)20)18(22)14-6-3-5-13(11-14)12-21-9-1-2-10-21/h3-8,11H,1-2,9-10,12H2

InChI key: InChIKey=ARDYNEROAUNCGD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• 2,3-Dichloro-3′-pyrrolidinomethyl benzophenone
• Methanone, (2,3-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

2,3-dichloro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-76-8

Formula: C₁₈H₁₇Cl₂NO

Purity: 97.0%

Molecular weight: 334.24

Ref: 10-F204807