CAS 898770-78-0

Methanone, (2,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a dichlorophenyl group indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and physical properties. The compound also features a pyrrolidinylmethyl substituent, suggesting potential interactions with biological systems, particularly in pharmacological contexts. This structure may confer specific properties such as lipophilicity, which can affect its solubility and permeability in biological membranes. Additionally, the compound's molecular configuration may play a role in its biological activity, making it of interest in medicinal chemistry. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with chlorinated compounds and nitrogen-containing heterocycles. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, with implications for research and application in various fields.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1S/C18H17Cl2NO/c19-15-6-7-16(17(20)11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

InChI key: InChIKey=WFLLLHAFLPJWHN-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC(CN3CCCC3)=CC=C2

Synonyms:

• Methanone, (2,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
• 2,4-Dichloro-3′-pyrrolidinomethyl benzophenone

2,4-dichloro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-78-0

Formula: C₁₈H₁₇Cl₂NO

Purity: 97.0%

Molecular weight: 334.24

Ref: 10-F204808