CAS 898770-80-4

(2,5-dichlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (2,5-dichlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898770-80-4, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a pyrrolidinylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It may possess moderate to high lipophilicity due to the presence of multiple aromatic rings, which can influence its solubility and permeability in biological systems. The dichlorophenyl moiety may enhance its reactivity and interaction with biological targets. Additionally, the presence of the pyrrolidine ring suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation for applications in drug development or as a research tool in biochemical studies.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1/C18H17Cl2NO/c19-15-6-7-17(20)16(11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

SMILES: C1CCN(C1)Cc1cccc(c1)C(=O)c1cc(ccc1Cl)Cl