CAS 898770-81-5
:ethyl 4-[4-(morpholinomethyl)phenyl]-4-oxo-butanoate
Description:
Ethyl 4-[4-(morpholinomethyl)phenyl]-4-oxo-butanoate, with the CAS number 898770-81-5, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group and a morpholine moiety. This compound typically exhibits properties associated with esters, such as being a liquid at room temperature and having a pleasant odor. The presence of the morpholinomethyl group suggests potential biological activity, as morpholine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound may also display moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic nature of the aromatic and aliphatic components. Additionally, the presence of the carbonyl group (oxo) indicates potential reactivity, making it a candidate for further chemical transformations. Overall, this compound's unique structure may contribute to its utility in various applications, including pharmaceuticals and agrochemicals, although specific biological or chemical properties would require empirical investigation.
Formula:C17H23NO4
InChI:InChI=1/C17H23NO4/c1-2-22-17(20)8-7-16(19)15-5-3-14(4-6-15)13-18-9-11-21-12-10-18/h3-6H,2,7-13H2,1H3
SMILES:CCOC(=O)CCC(=O)c1ccc(cc1)CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.