CymitQuimica logo

CAS 898770-82-6

:

Methanone, (3,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:
Methanone, (3,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The compound also features a pyrrolidinylmethyl group, suggesting potential interactions with biological systems, particularly in pharmacology. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological membranes. Additionally, the presence of halogen atoms like chlorine can enhance its potency and selectivity in various chemical reactions. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, although specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C18H17Cl2NO
InChI:InChI=1S/C18H17Cl2NO/c19-16-7-6-15(11-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2
InChI key:InChIKey=BYHONMZZZUEJSR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(Cl)=C(Cl)C=C3
Synonyms:
  • 3,4-Dichloro-3′-pyrrolidinomethyl benzophenone
  • (3,4-Dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
  • Methanone, (3,4-dichlorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.