CAS 898770-83-7

Ethyl 4-(4-morpholinylmethyl)-δ-oxobenzenepentanoate

Description:

Ethyl 4-(4-morpholinylmethyl)-δ-oxobenzenepentanoate, identified by its CAS number 898770-83-7, is a chemical compound that features a complex structure incorporating both an ester and a morpholine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic components. The presence of the morpholine ring suggests potential for biological activity, as morpholine derivatives are often explored in medicinal chemistry for their pharmacological properties. The δ-oxobenzenepentanoate structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a candidate for further research in synthetic organic chemistry and potential applications in drug development or agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₈H₂₅NO₄

InChI: InChI=1S/C18H25NO4/c1-2-23-18(21)5-3-4-17(20)16-8-6-15(7-9-16)14-19-10-12-22-13-11-19/h6-9H,2-5,10-14H2,1H3

InChI key: InChIKey=WHTNIRLKTMVGHF-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(CCCC(OCC)=O)=O)C=C1)N2CCOCC2

Synonyms:

• Ethyl 4-(4-morpholinylmethyl)-δ-oxobenzenepentanoate
• Benzenepentanoic acid, 4-(4-morpholinylmethyl)-δ-oxo-, ethyl ester