CAS 898770-84-8

(3,5-dichlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone

Description:

(3,5-Dichlorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, identified by its CAS number 898770-84-8, is a synthetic organic compound characterized by its complex structure that includes a dichlorophenyl group and a pyrrolidinylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may have significant lipophilicity, which can influence its solubility and permeability in biological systems. The pyrrolidine ring adds to the compound's structural diversity, potentially impacting its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including potential roles as pharmaceuticals or agrochemicals. The specific characteristics, such as melting point, boiling point, and reactivity, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development.

Formula: C₁₈H₁₇Cl₂NO

InChI: InChI=1/C18H17Cl2NO/c19-16-9-15(10-17(20)11-16)18(22)14-5-3-4-13(8-14)12-21-6-1-2-7-21/h3-5,8-11H,1-2,6-7,12H2

SMILES: C1CCN(C1)Cc1cccc(c1)C(=O)c1cc(cc(c1)Cl)Cl