CymitQuimica logo

CAS 898770-85-9

:

ethyl 6-[4-(morpholinomethyl)phenyl]-6-oxo-hexanoate

Description:
Ethyl 6-[4-(morpholinomethyl)phenyl]-6-oxo-hexanoate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a morpholinomethyl substituent. The presence of the morpholine ring suggests potential applications in medicinal chemistry, as morpholine derivatives are often associated with biological activity. The compound features a hexanoate backbone, which contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in drug development. Its CAS number, 898770-85-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in scientific literature and databases. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, highlighting its relevance in both synthetic and applied chemistry.
Formula:C19H27NO4
InChI:InChI=1/C19H27NO4/c1-2-24-19(22)6-4-3-5-18(21)17-9-7-16(8-10-17)15-20-11-13-23-14-12-20/h7-10H,2-6,11-15H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1ccc(cc1)CN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.