CAS 898770-86-0
:(2,4-difluorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (2,4-difluorophenyl)-[3-(pyrrolidin-1-ylmethyl)phenyl]methanone, with the CAS number 898770-86-0, is characterized by its complex molecular structure, which includes a difluorophenyl group and a pyrrolidinylmethyl substituent attached to a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of fluorine atoms can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the pyrrolidine ring may impart specific steric and electronic characteristics, potentially affecting its pharmacokinetics and pharmacodynamics. Such compounds are often investigated for their potential therapeutic applications, particularly in medicinal chemistry, where modifications to the phenyl and pyrrolidine moieties can lead to variations in activity and selectivity. Overall, this substance represents a class of organic compounds that may exhibit interesting chemical reactivity and biological properties, warranting further research and exploration in various fields, including drug development and materials science.
Formula:C18H17F2NO
InChI:InChI=1/C18H17F2NO/c19-15-6-7-16(17(20)11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2
SMILES:C1CCN(C1)Cc1cccc(c1)C(=O)c1ccc(cc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.