CAS 898770-88-2

Methanone, (3,4-difluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3,4-difluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of difluorophenyl and pyrrolidinylmethyl substituents contributes to its unique properties, including potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may influence its solubility in organic solvents and its interaction with biological membranes. The difluorination introduces electronegative fluorine atoms, which can affect the compound's reactivity and stability. Additionally, the pyrrolidine ring may impart specific steric and electronic characteristics that could be relevant in medicinal chemistry, particularly in the design of pharmaceuticals. Overall, this compound's structural features suggest it may have applications in drug development or as a research chemical, although specific biological activities would require further investigation.

Formula: C₁₈H₁₇F₂NO

InChI: InChI=1S/C18H17F2NO/c19-16-7-6-15(11-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2

InChI key: InChIKey=VUJFQCQPVIYONV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(F)=C(F)C=C3

Synonyms:

• (3,4-Difluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, (3,4-difluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

3,4-difluoro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-88-2

Formula: C₁₈H₁₇F₂NO

Purity: 97.0%

Molecular weight: 301.337

Ref: 10-F204813