CAS 898770-93-9

Methanone, (2-methylphenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[4-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidinylmethyl substituent indicates that it has a nitrogen-containing heterocyclic component, which can influence its chemical reactivity and biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in hydrogen bonding, which can affect its solubility in various solvents. The aromatic rings contribute to its stability and may also play a role in interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group on one of the phenyl rings can affect the steric and electronic properties of the molecule, potentially influencing its pharmacological profile. Overall, this compound's unique structure suggests potential applications in drug development or as a chemical intermediate in synthesis.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-16-7-3-4-8-19(16)20(22)18-11-9-17(10-12-18)15-21-13-5-2-6-14-21/h3-4,7-12H,2,5-6,13-15H2,1H3

InChI key: InChIKey=WMDRKNUTYFYMGJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3=C(C)C=CC=C3

Synonyms:

• 2-Methyl-4′-piperidinomethyl benzophenone
• Methanone, (2-methylphenyl)[4-(1-piperidinylmethyl)phenyl]-