CAS 898770-95-1

m-tolyl-[4-(1-piperidylmethyl)phenyl]methanone

Description:

m-Tolyl-[4-(1-piperidylmethyl)phenyl]methanone, also known by its CAS number 898770-95-1, is an organic compound characterized by its complex structure, which includes a ketone functional group and a piperidine moiety. This compound features a tolyl group (derived from toluene) attached to a phenyl ring, which is further substituted with a piperidylmethyl group. The presence of the ketone functional group suggests potential reactivity in various chemical reactions, including nucleophilic additions and reductions. The piperidine ring contributes to the compound's potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound's molecular structure may influence its solubility, stability, and interaction with biological targets. Overall, m-tolyl-[4-(1-piperidylmethyl)phenyl]methanone represents a class of compounds that may have applications in medicinal chemistry and drug development, warranting further investigation into its properties and potential uses.

Formula: C₂₀H₂₃NO

InChI: InChI=1/C20H23NO/c1-16-6-5-7-19(14-16)20(22)18-10-8-17(9-11-18)15-21-12-3-2-4-13-21/h5-11,14H,2-4,12-13,15H2,1H3

SMILES: Cc1cccc(c1)C(=O)c1ccc(cc1)CN1CCCCC1

3-methyl-4′-piperidinomethyl benzophenone

CAS: 898770-95-1

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F204258