CAS 898770-96-2

Cyclobutyl[3-(1-pyrrolidinylmethyl)phenyl]methanone

Description:

Cyclobutyl[3-(1-pyrrolidinylmethyl)phenyl]methanone, identified by its CAS number 898770-96-2, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclobutyl group and a phenyl ring substituted with a pyrrolidinylmethyl moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It may possess moderate to high lipophilicity due to the presence of the cyclobutyl and phenyl groups, which can influence its solubility in organic solvents. The pyrrolidinyl group may impart certain biological activities, making this compound of interest in medicinal chemistry and drug development. Its reactivity is likely influenced by the carbonyl group, allowing for potential interactions in various chemical reactions. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₁₆H₂₁NO

InChI: InChI=1S/C16H21NO/c18-16(14-6-4-7-14)15-8-3-5-13(11-15)12-17-9-1-2-10-17/h3,5,8,11,14H,1-2,4,6-7,9-10,12H2

InChI key: InChIKey=FRULAKPZZZCKKX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3CCC3

Synonyms:

• Cyclobutyl[3-(1-pyrrolidinylmethyl)phenyl]methanone
• Methanone, cyclobutyl[3-(1-pyrrolidinylmethyl)phenyl]-

cyclobutyl 3-(pyrrolidinomethyl)phenyl ketone

CAS: 898770-96-2

Formula: C₁₆H₂₁NO

Purity: 97.0%

Molecular weight: 243.35

Ref: 10-F204817