CAS 898770-97-3
:[4-(1-piperidylmethyl)phenyl]-(p-tolyl)methanone
Description:
[4-(1-Piperidylmethyl)phenyl]-(p-tolyl)methanone, with the CAS number 898770-97-3, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and two aromatic groups. This compound typically exhibits properties associated with ketones, such as being a solid at room temperature, with potential solubility in organic solvents like ethanol and dimethyl sulfoxide. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound may also display moderate to high lipophilicity due to the aromatic groups, influencing its interaction with biological membranes. Additionally, it may undergo typical reactions of ketones, such as nucleophilic addition and oxidation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C20H23NO
InChI:InChI=1/C20H23NO/c1-16-5-9-18(10-6-16)20(22)19-11-7-17(8-12-19)15-21-13-3-2-4-14-21/h5-12H,2-4,13-15H2,1H3
SMILES:Cc1ccc(cc1)C(=O)c1ccc(cc1)CN1CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.