CAS 898771-02-3

Ethyl γ-oxo-3-(1-pyrrolidinylmethyl)benzenebutanoate

Description:

Ethyl γ-oxo-3-(1-pyrrolidinylmethyl)benzenebutanoate, identified by its CAS number 898771-02-3, is a chemical compound that features a complex structure incorporating both an ester and a ketone functional group. This compound is characterized by its ethyl ester moiety, which contributes to its solubility in organic solvents and potential applications in organic synthesis. The presence of the pyrrolidine ring suggests that it may exhibit interesting pharmacological properties, as pyrrolidine derivatives are often associated with various biological activities. The compound's structure includes a benzene ring, which can influence its reactivity and interaction with biological systems. Additionally, the γ-oxo group indicates that it may participate in various chemical reactions, such as condensation or nucleophilic attacks. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and synthetic organic chemistry, although specific applications and biological activities would require further investigation.

Formula: C₁₇H₂₃NO₃

InChI: InChI=1S/C17H23NO3/c1-2-21-17(20)9-8-16(19)15-7-5-6-14(12-15)13-18-10-3-4-11-18/h5-7,12H,2-4,8-11,13H2,1H3

InChI key: InChIKey=FXQNDXIGUZVPLC-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCC(OCC)=O)=O)=CC=C1)N2CCCC2

Synonyms:

• Ethyl γ-oxo-3-(1-pyrrolidinylmethyl)benzenebutanoate
• Benzenebutanoic acid, γ-oxo-3-(1-pyrrolidinylmethyl)-, ethyl ester