CAS 898771-03-4

(4-methoxyphenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

The chemical substance known as (4-methoxyphenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898771-03-4, is an organic compound characterized by its complex structure, which includes a methoxy group and a piperidylmethyl substituent. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The methoxy group can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Additionally, the aromatic rings in its structure may contribute to its stability and electronic properties. Overall, this compound's unique structural features may lead to diverse applications, particularly in drug development and research into therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1/C20H23NO2/c1-23-19-11-9-18(10-12-19)20(22)17-7-5-16(6-8-17)15-21-13-3-2-4-14-21/h5-12H,2-4,13-15H2,1H3

SMILES: COc1ccc(cc1)C(=O)c1ccc(cc1)CN1CCCCC1

4-methoxy-4′-piperidinomethyl benzophenone

CAS: 898771-03-4

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204262