CAS 898771-04-5

Ethyl δ-oxo-3-(1-pyrrolidinylmethyl)benzenepentanoate

Description:

Ethyl δ-oxo-3-(1-pyrrolidinylmethyl)benzenepentanoate, identified by its CAS number 898771-04-5, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a pyrrolidine moiety. This compound typically exhibits properties common to esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the pyrrolidine ring suggests potential biological activity, as pyrrolidine derivatives are often explored for their pharmacological properties. The compound may also display specific reactivity due to the ketone and ester functionalities, making it a candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its physical and chemical properties, as well as its biological activity, would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₈H₂₅NO₃

InChI: InChI=1S/C18H25NO3/c1-2-22-18(21)10-6-9-17(20)16-8-5-7-15(13-16)14-19-11-3-4-12-19/h5,7-8,13H,2-4,6,9-12,14H2,1H3

InChI key: InChIKey=VBLZGUDBCSCOOJ-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCCC(OCC)=O)=O)=CC=C1)N2CCCC2

Synonyms:

• Benzenepentanoic acid, δ-oxo-3-(1-pyrrolidinylmethyl)-, ethyl ester
• Ethyl δ-oxo-3-(1-pyrrolidinylmethyl)benzenepentanoate

ethyl 5-oxo-5-[3-(pyrrolidinomethyl)phenyl]valerate

CAS: 898771-04-5

Formula: C₁₈H₂₅NO₃

Purity: 97.0%

Molecular weight: 303.402

Ref: 10-F204821