CAS 898771-05-6

2-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile

Description:

2-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile, with the CAS number 898771-05-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzonitrile moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperidine group suggests it may interact with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular structure may confer specific reactivity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, the presence of functional groups such as the benzoyl and nitrile groups may enhance its chemical reactivity and potential for forming derivatives. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and biological applications.

Formula: C₂₀H₂₀N₂O

InChI: InChI=1S/C20H20N2O/c21-14-18-6-2-3-7-19(18)20(23)17-10-8-16(9-11-17)15-22-12-4-1-5-13-22/h2-3,6-11H,1,4-5,12-13,15H2

InChI key: InChIKey=TYWZKTMRJGUSSO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C#N)C=CC=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• 2-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile
• Benzonitrile, 2-[4-(1-piperidinylmethyl)benzoyl]-

2-Cyano-4′-piperidinomethyl benzophenone

CAS: 898771-05-6

Formula: C₂₀H₂₀N₂O

Purity: 97.0%

Molecular weight: 304.393

Ref: 10-F204263