CymitQuimica logo

CAS 898771-06-7

:

(2,6-Dimethylphenyl)-3-thienylmethanone

Description:
(2,6-Dimethylphenyl)-3-thienylmethanone, with the CAS number 898771-06-7, is an organic compound characterized by its unique structure, which includes a thienyl group and a dimethylphenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The thienyl ring contributes to its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. The presence of the two methyl groups on the phenyl ring can influence steric hindrance and electronic distribution, affecting its solubility and interaction with other molecules. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals or as a building block for more complex chemical structures. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C13H12OS
InChI:InChI=1S/C13H12OS/c1-9-4-3-5-10(2)12(9)13(14)11-6-7-15-8-11/h3-8H,1-2H3
InChI key:InChIKey=MULGTBPSRZCDAR-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=C1C)C=2C=CSC2
Synonyms:
  • Methanone, (2,6-dimethylphenyl)-3-thienyl-
  • (2,6-Dimethylphenyl)-3-thienylmethanone
  • (2,6-Dimethylphenyl)-thiophen-3-ylmethanone
  • (2,6-Dimethylphenyl)(thiophen-3-yl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.