CAS 898771-08-9

3-[4-(1-piperidylmethyl)benzoyl]benzonitrile

Description:

3-[4-(1-Piperidylmethyl)benzoyl]benzonitrile, with the CAS number 898771-08-9, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a piperidine ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the nitrile functional group indicates that it may exhibit unique reactivity and solubility properties. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in treating various medical conditions. The molecular structure suggests that it may interact with biological targets, making it of interest in drug discovery and development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic rings and the piperidine moiety. Overall, 3-[4-(1-piperidylmethyl)benzoyl]benzonitrile represents a class of compounds that may hold promise in therapeutic applications, warranting further research into its properties and effects.

Formula: C₂₀H₂₀N₂O

InChI: InChI=1/C20H20N2O/c21-14-17-5-4-6-19(13-17)20(23)18-9-7-16(8-10-18)15-22-11-2-1-3-12-22/h4-10,13H,1-3,11-12,15H2

SMILES: C1CCN(CC1)Cc1ccc(cc1)C(=O)c1cccc(c1)C#N

Synonyms:

• Benzonitrile, 3-[4-(1-piperidinylmethyl)benzoyl]-
• 3-CYANO-4'-PIPERIDINOMETHYL BENZOPHENONE

3-cyano-4′-piperidinomethyl benzophenone

CAS: 898771-08-9

Formula: C₂₀H₂₀N₂O

Purity: 97.0%

Molecular weight: 304.393

Ref: 10-F204264