CAS 898771-09-0
:(3,4-Dimethylphenyl)-3-thienylmethanone
Description:
(3,4-Dimethylphenyl)-3-thienylmethanone, identified by its CAS number 898771-09-0, is an organic compound characterized by its unique structure, which includes a thienyl group and a dimethyl-substituted phenyl group. This compound typically exhibits properties associated with aromatic ketones, such as a relatively high melting point and solubility in organic solvents. The presence of the thienyl moiety contributes to its potential reactivity and interaction with various biological systems, making it of interest in medicinal chemistry and material science. The dimethyl substitutions on the phenyl ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and stability. Additionally, compounds of this nature may exhibit interesting optical properties, which can be harnessed in applications such as organic light-emitting diodes (OLEDs) or as intermediates in synthetic organic chemistry. Overall, (3,4-Dimethylphenyl)-3-thienylmethanone represents a versatile structure with potential applications across various fields of chemistry.
Formula:C13H12OS
InChI:InChI=1/C13H12OS/c1-9-3-4-11(7-10(9)2)13(14)12-5-6-15-8-12/h3-8H,1-2H3
InChI key:InChIKey=IQMJFXWAOQVFJM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(C)C=C1)C=2C=CSC2
Synonyms:- Methanone, (3,4-dimethylphenyl)-3-thienyl-
- (3,4-Dimethylphenyl)-3-thienylmethanone
- (3,4-Dimethylphenyl)(thiophen-3-yl)methanone
- 3-(3,4-DIMETHYLBENZOYL)THIOPHENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.