CAS 898771-11-4
:4-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile
Description:
4-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile, with the CAS number 898771-11-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzonitrile moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperidine group suggests that it may interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic character. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry for the development of therapeutic agents. Additionally, the presence of functional groups such as the benzoyl and nitrile groups may enhance its reactivity and ability to form derivatives. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.
Formula:C20H20N2O
InChI:InChI=1/C20H20N2O/c21-14-16-4-8-18(9-5-16)20(23)19-10-6-17(7-11-19)15-22-12-2-1-3-13-22/h4-11H,1-3,12-13,15H2
InChI key:InChIKey=FCWDJLRBGRHMGB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(C#N)C=C3
Synonyms:- 4-[4-(1-Piperidinylmethyl)benzoyl]benzonitrile
- Benzonitrile, 4-[4-(1-piperidinylmethyl)benzoyl]-
- 4-(4-(Piperidin-1-ylmethyl)benzoyl)benzonitrile
- 4-CYANO-4'-PIPERIDINOMETHYL BENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.