CAS 898771-21-6

(3-chloro-4-fluoro-phenyl)-(3-thienyl)methanone

Description:

(3-chloro-4-fluoro-phenyl)-(3-thienyl)methanone is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with chlorine and fluorine atoms, as well as a thienyl group. The presence of these substituents contributes to its chemical reactivity and potential biological activity. The compound features a ketone functional group, which is indicative of its ability to participate in various chemical reactions, such as nucleophilic additions. Its molecular structure suggests that it may exhibit interesting properties, including potential applications in pharmaceuticals or agrochemicals, due to the presence of halogen atoms that can influence lipophilicity and biological interactions. Additionally, the thienyl moiety may impart specific electronic properties, enhancing its reactivity or selectivity in chemical processes. Overall, (3-chloro-4-fluoro-phenyl)-(3-thienyl)methanone is a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation into its properties and applications.

Formula: C₁₁H₆ClFOS

InChI: InChI=1/C11H6ClFOS/c12-9-5-7(1-2-10(9)13)11(14)8-3-4-15-6-8/h1-6H

SMILES: c1cc(c(cc1C(=O)c1ccsc1)Cl)F