CAS 898771-22-7

Methanone, [3-(1-azetidinylmethyl)phenyl](3-methylphenyl)-

Description:

Methanone, [3-(1-azetidinylmethyl)phenyl](3-methylphenyl)-, also known by its CAS number 898771-22-7, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with an azetidinylmethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the azetidine ring suggests potential for specific stereochemical configurations, which may affect its biological activity. Methanones are generally known for their role in organic synthesis and can serve as intermediates in the production of pharmaceuticals and agrochemicals. The compound's solubility, stability, and reactivity can vary based on the substituents on the phenyl rings and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₁₈H₁₉NO

InChI: InChI=1S/C18H19NO/c1-14-5-2-7-16(11-14)18(20)17-8-3-6-15(12-17)13-19-9-4-10-19/h2-3,5-8,11-12H,4,9-10,13H2,1H3

InChI key: InChIKey=OFIOZHSWLALCNZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC(C)=CC=C3

Synonyms:

• Methanone, [3-(1-azetidinylmethyl)phenyl](3-methylphenyl)-
• [3-(1-Azetidinylmethyl)phenyl](3-methylphenyl)methanone