CAS 898771-23-8

[2-(Methylthio)phenyl][4-(1-piperidinylmethyl)phenyl]methanone

Description:

The chemical substance known as [2-(Methylthio)phenyl][4-(1-piperidinylmethyl)phenyl]methanone, with the CAS number 898771-23-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of a methylthio group indicates that it contains a sulfur atom bonded to a methyl group, which can influence its reactivity and solubility. The piperidinylmethyl moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals due to their ability to interact with various biological targets. This compound may exhibit properties such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, its structural features may contribute to specific interactions with receptors or enzymes, making it of interest in medicinal chemistry. Overall, the compound's unique combination of functional groups and structural elements positions it as a candidate for further research in drug development and related fields.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-23-19-8-4-3-7-18(19)20(22)17-11-9-16(10-12-17)15-21-13-5-2-6-14-21/h3-4,7-12H,2,5-6,13-15H2,1H3

InChI key: InChIKey=UMSRVJRBPYWLBT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• [2-(Methylthio)phenyl][4-(1-piperidinylmethyl)phenyl]methanone
• Methanone, [2-(methylthio)phenyl][4-(1-piperidinylmethyl)phenyl]-

4′-piperidinomethyl-2-thiomethylbenzophenone

CAS: 898771-23-8

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F204269