CAS 898771-29-4

(3-bromophenyl)-[4-(1-piperidylmethyl)phenyl]methanone

Description:

(3-bromophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898771-29-4, is a chemical compound that features a complex structure incorporating both aromatic and aliphatic components. It contains a bromine atom attached to a phenyl ring, which enhances its reactivity and potential biological activity. The presence of a piperidine moiety suggests that this compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The ketone functional group in the structure indicates that it can participate in various chemical reactions, such as nucleophilic additions. This compound may also display specific solubility characteristics, depending on the solvent used, and its interactions with biological targets could be influenced by the steric and electronic effects of the bromine and piperidine groups. Overall, the unique combination of functional groups in (3-bromophenyl)-[4-(1-piperidylmethyl)phenyl]methanone suggests potential applications in drug discovery and development, particularly in areas targeting neurological or psychiatric conditions.

Formula: C₁₉H₂₀BrNO

InChI: InChI=1/C19H20BrNO/c20-18-6-4-5-17(13-18)19(22)16-9-7-15(8-10-16)14-21-11-2-1-3-12-21/h4-10,13H,1-3,11-12,14H2

InChI key: InChIKey=UXZNNOKIXLKJBA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• (3-Bromophenyl)[4-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (3-bromophenyl)[4-(1-piperidinylmethyl)phenyl]-

3-bromo-4′-piperidinomethyl benzophenone

CAS: 898771-29-4

Formula: C₁₉H₂₀BrNO

Purity: 97.0%

Molecular weight: 358.279

Ref: 10-F204271