CAS 898771-31-8
:Methanone, [3-(1-azetidinylmethyl)phenyl](3-methoxyphenyl)-
Description:
Methanone, [3-(1-azetidinylmethyl)phenyl](3-methoxyphenyl)-, also known by its CAS number 898771-31-8, is a chemical compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with both an azetidine moiety and a methoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the azetidine ring suggests potential for biological activity, as many compounds containing nitrogen heterocycles are known for their pharmacological properties. Additionally, the methoxy group can enhance solubility and affect the compound's electronic properties. The overall molecular structure may contribute to its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C18H19NO2
InChI:InChI=1S/C18H19NO2/c1-21-17-8-3-7-16(12-17)18(20)15-6-2-5-14(11-15)13-19-9-4-10-19/h2-3,5-8,11-12H,4,9-10,13H2,1H3
InChI key:InChIKey=VLCUIAYHRMSOGP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCC2)=CC=C1)C3=CC(OC)=CC=C3
Synonyms:- [3-(1-Azetidinylmethyl)phenyl](3-methoxyphenyl)methanone
- Methanone, [3-(1-azetidinylmethyl)phenyl](3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.