CAS 898771-32-9
:Methanone, (4-bromophenyl)[4-(1-piperidinylmethyl)phenyl]-
Description:
Methanone, (4-bromophenyl)[4-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a bromine atom on one of the phenyl groups contributes to its reactivity and potential applications in medicinal chemistry. The piperidinylmethyl substituent enhances its pharmacological properties, making it of interest in drug development, particularly in the context of neuroactive compounds. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, influencing its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can pose health risks. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.
Formula:C19H20BrNO
InChI:InChI=1S/C19H20BrNO/c20-18-10-8-17(9-11-18)19(22)16-6-4-15(5-7-16)14-21-12-2-1-3-13-21/h4-11H,1-3,12-14H2
InChI key:InChIKey=OXJYMLITXZYWHU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(Br)C=C3
Synonyms:- Methanone, (4-bromophenyl)[4-(1-piperidinylmethyl)phenyl]-
- (4-Bromophenyl)[4-(1-piperidinylmethyl)phenyl]methanone
- 4-Bromo-4′-piperidinomethyl benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.