CAS 898771-35-2

Methanone, (3-chlorophenyl)[4-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3-chlorophenyl)[4-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and a piperidine moiety. The presence of a chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests potential interactions with biological targets, making this compound of interest in medicinal chemistry. Its molecular structure contributes to its properties, such as solubility, stability, and potential pharmacological effects. The compound may exhibit specific interactions with receptors or enzymes due to its functional groups, which can be explored in drug development. Additionally, the presence of halogen atoms like chlorine often enhances lipophilicity, affecting the compound's distribution in biological systems. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1/C19H20ClNO/c20-18-6-4-5-17(13-18)19(22)16-9-7-15(8-10-16)14-21-11-2-1-3-12-21/h4-10,13H,1-3,11-12,14H2

InChI key: InChIKey=MWWZJUMHBYIWPM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCCCC3)C=C2

Synonyms:

• Methanone, (3-chlorophenyl)[4-(1-piperidinylmethyl)phenyl]-
• (3-Chlorophenyl)[4-(1-piperidinylmethyl)phenyl]methanone