CAS 898771-37-4
:(4-chlorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-chlorophenyl)-[4-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898771-37-4, is an organic compound characterized by its complex structure, which includes a ketone functional group and a piperidine moiety. This compound features a chlorinated phenyl group, contributing to its potential biological activity and lipophilicity. The presence of the piperidyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as moderate to high solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. The compound's potential applications could span various fields, including pharmaceuticals, where it may serve as a lead compound for drug development. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C19H20ClNO
InChI:InChI=1/C19H20ClNO/c20-18-10-8-17(9-11-18)19(22)16-6-4-15(5-7-16)14-21-12-2-1-3-13-21/h4-11H,1-3,12-14H2
SMILES:C1CCN(CC1)Cc1ccc(cc1)C(=O)c1ccc(cc1)Cl
Synonyms:- 4-CHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
- (4-Chlorophenyl)(4-(piperidin-1-ylmethyl)phenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.